Products 2121513-38-8
CAS 2121513-38-8 appears in our catalog under these names: 2,4-Difluoro-6-bromophenylboronic acid pinacol ester, 95%, 2,4-Difluoro-6-bromophenylboronic acid pinacol ester, 95%, 95%, 2,4-Difluoro-6-bromophenylboronic acid pinacol ester. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
2-(2-bromo-4,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-38-8) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(2-bromo-4,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ASAQCQPVCFSRQX-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(2-bromo-4,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ASAQCQPVCFSRQX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2Br)F)F |
Computed by PubChem (NCBI)