cas: 916516-89-7 — see every product listed under this CAS number, including other names
2-(4-Bromo-2-chlorophenyl)acetic Acid, 98%, 98% (CAS 916516-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149JQ-250mg |
| cas | 916516-89-7 |
| size | 250mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 424.40 Pln | |
| Chemat | 25g | 933.20 Pln | |
| Chemat | 100g | 2934.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromo-2-chlorophenyl)acetic acid (CAS 916516-89-7) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)acetic acid. InChIKey: ZCWUQSVZPLUCOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)acetic acid |
| InChIKey | ZCWUQSVZPLUCOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)CC(=O)O |
Computed by PubChem (NCBI)