Products 39784-10-6

CAS 39784-10-6 is the registry number for (2-Bromophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-bromophenoxy)acetyl chloride (CAS 39784-10-6) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(2-bromophenoxy)acetyl chloride. InChIKey: PONCSXBMRXZDAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO2
Molecular weight249.49 g/mol
IUPAC name2-(2-bromophenoxy)acetyl chloride
InChIKeyPONCSXBMRXZDAF-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCC(=O)Cl)Br

Computed by PubChem (NCBI)