CAS 27007-53-0 appears in our catalog under these names: Methyl 2-bromo-5-chlorobenzoate, 98%, Methyl 2–bromo–5–chlorobenzoate, Methyl 2-bromo-5-chlorobenzoate, 98% , 2-Bromo-5-chlorobenzoic acid methyl ester, Methyl 2-Bromo-5-chlorobenzoate, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 500g, 100g, 1kg, 25g, 0,1kg, 0,25kg, 5g, 50g.
Methyl 2-bromo-5-chlorobenzoate (CAS 27007-53-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 2-bromo-5-chlorobenzoate. InChIKey: BIECSXCXIXHDBC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 2-bromo-5-chlorobenzoate |
| InChIKey | BIECSXCXIXHDBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)Br |
Computed by PubChem (NCBI)