CAS 29270-30-2 appears in our catalog under these names: 2-Bromo-2-(2-chlorophenyl)acetic Acid, 2-Bromo-2-(2-chlorophenyl)acetic acid, 97%, 2-Bromo-2-(2-chlorophenyl)acetic acid 97%, 2-Bromo-2-(2-chlorophenyl)acetic acid, 97%, 97%, alpha-Bromo-2-chlorophenylacetic Acid, >98.0%(GC)(T). Offered by: TRC, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250g, 25g, 5g, 10g, 100g, 500g, 1kg.
2-bromo-2-(2-chlorophenyl)acetic acid (CAS 29270-30-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-bromo-2-(2-chlorophenyl)acetic acid. InChIKey: XHAPROULWZYBGA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-bromo-2-(2-chlorophenyl)acetic acid |
| InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)Br)Cl |
Computed by PubChem (NCBI)