Products 29270-30-2
CAS 29270-30-2 appears in our catalog under these names: 2-Bromo-2-(2-chlorophenyl)acetic Acid, 2-Bromo-2-(2-chlorophenyl)acetic acid, 97%, 2-Bromo-2-(2-chlorophenyl)acetic acid, 95%, 2-Bromo-2-(2-chlorophenyl)acetic acid, 97%, 97%, alpha-Bromo-2-chlorophenylacetic Acid, >98.0%(GC)(T). Offered by: TRC, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250g, 25g, 100g, 1kg, 500g, 5g, 1g, 10g.
2-bromo-2-(2-chlorophenyl)acetic acid (CAS 29270-30-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-bromo-2-(2-chlorophenyl)acetic acid. InChIKey: XHAPROULWZYBGA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-bromo-2-(2-chlorophenyl)acetic acid |
| InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)Br)Cl |
Computed by PubChem (NCBI)
Synonyms:
alpha-Bromo-2-chlorobenzeneacetic acid, alpha-Bromo-2-chlorophenylacetic acid, 2-bromo-2-(2-chlorophenyl)acetic Acid, 2-Bromo-2-(2'-chlorophenyl) acetic acid, bromo(2-chlorophenyl)acetic acid, alpha-Bromo-2-chlorophenyl acetic acid, Benzeneacetic acid, alpha-bromo-2-chloro-, a-bromo-2-chlorophenylacetic acid, alpha-Bromo(2-Chloro)Phenylacetic Acid, Alapha-bromo-(2-chloro)-phenylacetic acid