Products 66658-57-9

CAS 66658-57-9 is the registry number for 5-(Bromomethyl)-2-chlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(bromomethyl)-2-chlorobenzoic acid (CAS 66658-57-9) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 5-(bromomethyl)-2-chlorobenzoic acid. InChIKey: ZHFJIITZHYWVAL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO2
Molecular weight249.49 g/mol
IUPAC name5-(bromomethyl)-2-chlorobenzoic acid
InChIKeyZHFJIITZHYWVAL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CBr)C(=O)O)Cl

Computed by PubChem (NCBI)