cas: 477841-90-0 — see every product listed under this CAS number, including other names
2-(4-Bromobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 477841-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBMO-100mg |
| cas | 477841-90-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 500mg | 1614.80 Pln | |
| Chemat | 1g | 2392.40 Pln | |
| Chemat | 5g | 7048.40 Pln | |
| Chemat | 10g | 12318.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 477841-90-0) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GRYKRVPNXCGBIT-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GRYKRVPNXCGBIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)