cas: 477841-90-0 — see every product listed under this CAS number, including other names
2-(4-Bromobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 477841-90-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A237888-5g |
| cas | 477841-90-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17842.30 Pln | |
| AmBeed | 10g | 21572.53 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 477841-90-0) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GRYKRVPNXCGBIT-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GRYKRVPNXCGBIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)