cas: 71703-16-7 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)isothiazolidine 1,1-dioxide (CAS 71703-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212664-250MG |
| cas | 71703-16-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 716.43 Pln | |
| Fluorochem | 5g | 1788.97 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-16-7) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: LYQGSNNXYYJBLO-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | LYQGSNNXYYJBLO-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)