cas: 53086-53-6 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)propanoic acid 95% (CAS 53086-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A626398-100mg |
| cas | 53086-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3212.81 Pln | |
| Ambeed | 10g | 5098.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A626398 |
2-(4-bromophenyl)propanoic acid (CAS 53086-53-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(4-bromophenyl)propanoic acid. InChIKey: PFDBEACWLCHWRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(4-bromophenyl)propanoic acid |
| InChIKey | PFDBEACWLCHWRZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)