CAS 170737-95-8 appears in our catalog under these names: 2–(4–Chloro–2–methoxyphenyl)acetic acid, 2-(4-chloro-2-methoxyphenyl)acetic acid, 2-(4-Chloro-2-methoxyphenyl)acetic acid, 98%, 98%, 2-(4-CHLORO-2-METHOXYPHENYL)ACETIC ACID, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g.
2-(4-chloro-2-methoxyphenyl)acetic acid (CAS 170737-95-8) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(4-chloro-2-methoxyphenyl)acetic acid. InChIKey: UXJIWCMQVOEXTG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(4-chloro-2-methoxyphenyl)acetic acid |
| InChIKey | UXJIWCMQVOEXTG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)CC(=O)O |
Computed by PubChem (NCBI)