cas: 30568-32-2 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-2-methylpropanenitrile, 95-<97% (CAS 30568-32-2) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC2469-95-97-2.5g |
| cas | 30568-32-2 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3829.76 Pln | |
| Hoffman Fine Chemicals | 5g | 5941.54 Pln | |
| Hoffman Fine Chemicals | 10g | 9322.94 Pln | |
| Hoffman Fine Chemicals | 25g | 18337.88 Pln | |
| Hoffman Fine Chemicals | 50g | 29158.36 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-2-methylpropanenitrile (CAS 30568-32-2) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-methylpropanenitrile. InChIKey: GQOLYABRQATDOI-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-methylpropanenitrile |
| InChIKey | GQOLYABRQATDOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)