Products 22217-78-3
CAS 22217-78-3 appears in our catalog under these names: 5-(4-Chloro-phenyl)-3,4-dihydro-2h-pyrrole, 95%, 5-(4-Chlorophenyl)-3,4-dihydro-2H-pyrrole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole (CAS 22217-78-3) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: RMQRHIVCPGFNHY-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | RMQRHIVCPGFNHY-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)