CAS 1316312-24-9 appears in our catalog under these names: Tolvaptan Impurity 35, Tolvaptan Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
7-chloro-2,3-dihydro-1H-1-benzazepine (CAS 1316312-24-9) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1H-1-benzazepine. InChIKey: FSKMHCDLPSXAEH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1H-1-benzazepine |
| InChIKey | FSKMHCDLPSXAEH-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)