Products 374588-99-5
CAS 374588-99-5 appears in our catalog under these names: 5-(3-Chlorophenyl)-3,4-dihydro-2h-pyrrole, 95%, 5-(3-Chlorophenyl)-3,4-dihydro-2H-pyrrole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole (CAS 374588-99-5) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: 5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: FHVNCODOPTYOJD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | FHVNCODOPTYOJD-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)