CAS 552-46-5 appears in our catalog under these names: 1-Naphthylamine hydrochloride, 98%, 1-Naphthylamine Hydrochloride, >98.0%(HPLC), 1-Naphthylamine Hydrochloride. Offered by: Combi-blocks, TCI, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g.
Naphthalen-1-amine;hydrochloride (CAS 552-46-5) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: naphthalen-1-amine;hydrochloride. InChIKey: FOKKJVHTXPJHEN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | naphthalen-1-amine;hydrochloride |
| InChIKey | FOKKJVHTXPJHEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N.Cl |
Computed by PubChem (NCBI)