cas: 7386-21-2 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)isoindoline-1,3-dione, 98%, 98% (CAS 7386-21-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SCB-5g |
| cas | 7386-21-2 |
| size | 5g |
| availability | 110g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 645.20 Pln | |
| Chemat | 100g | 1811.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)isoindole-1,3-dione (CAS 7386-21-2) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(4-chlorophenyl)isoindole-1,3-dione. InChIKey: QKHKQJWODBAIMN-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)isoindole-1,3-dione |
| InChIKey | QKHKQJWODBAIMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)