cas: 91517-25-8 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)piperazine (CAS 91517-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049242-100MG |
| cas | 91517-25-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 1247.50 Pln |
| delivery time | 2-3 weeks |
|---|
2-(4-chlorophenyl)piperazine (CAS 91517-25-8) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-(4-chlorophenyl)piperazine. InChIKey: OTOVNNDSINVUBR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)piperazine |
| InChIKey | OTOVNNDSINVUBR-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)