cas: 721920-84-9 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)thiazole-5-carbaldehyde, 95%, 95% (CAS 721920-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117048-100mg |
| cas | 721920-84-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2440.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde (CAS 721920-84-9) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: QJHQBOBUAOFVLH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | QJHQBOBUAOFVLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)C=O)Cl |
Computed by PubChem (NCBI)