cas: 1147105-68-7 — see every product listed under this CAS number, including other names
2-(4-Ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 1147105-68-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A980288-250mg |
| cas | 1147105-68-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A980288 |
2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1147105-68-7) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YEUFTLGWZJBVII-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YEUFTLGWZJBVII-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC |
Computed by PubChem (NCBI)