cas: 1147105-68-7 — see every product listed under this CAS number, including other names
2-(4-Ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1147105-68-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F615719-1G |
| cas | 1147105-68-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1190.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1147105-68-7) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YEUFTLGWZJBVII-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YEUFTLGWZJBVII-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC |
Computed by PubChem (NCBI)