cas: 451-88-7 — see every product listed under this CAS number, including other names
2-(4-Fluoro-2-methylphenoxy)acetic acid, 98% (CAS 451-88-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A757640-10g |
| cas | 451-88-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12764.50 Pln | |
| AmBeed | 100mg | 1085.56 Pln | |
| AmBeed | 5g | 9294.67 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-fluoro-2-methylphenoxy)acetic acid (CAS 451-88-7) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenoxy)acetic acid. InChIKey: MJESFQARYVVZSL-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenoxy)acetic acid |
| InChIKey | MJESFQARYVVZSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OCC(=O)O |
Computed by PubChem (NCBI)