Products 870221-15-1

CAS 870221-15-1 is the registry number for 2-Fluoro-5-methoxy-4-methylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

2-fluoro-5-methoxy-4-methylbenzoic acid (CAS 870221-15-1) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-fluoro-5-methoxy-4-methylbenzoic acid. InChIKey: NLOLGIGDSLJISN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO3
Molecular weight184.16 g/mol
IUPAC name2-fluoro-5-methoxy-4-methylbenzoic acid
InChIKeyNLOLGIGDSLJISN-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OC)C(=O)O)F

Computed by PubChem (NCBI)