CAS 105836-28-0 is the registry number for Ethyl 2-fluoro-3-hydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-fluoro-3-hydroxybenzoate (CAS 105836-28-0) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: ethyl 2-fluoro-3-hydroxybenzoate. InChIKey: GCYCCDMPSNIVDM-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | ethyl 2-fluoro-3-hydroxybenzoate |
| InChIKey | GCYCCDMPSNIVDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)O)F |
Computed by PubChem (NCBI)