Products 103441-02-7

CAS 103441-02-7 is the registry number for 2-(2-Fluorophenyl)-2-methoxyacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

2-(2-fluorophenyl)-2-methoxyacetic acid (CAS 103441-02-7) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-methoxyacetic acid. InChIKey: VEMIKFLPRKIXGA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO3
Molecular weight184.16 g/mol
IUPAC name2-(2-fluorophenyl)-2-methoxyacetic acid
InChIKeyVEMIKFLPRKIXGA-UHFFFAOYSA-N
SMILESCOC(C1=CC=CC=C1F)C(=O)O

Computed by PubChem (NCBI)