CAS 451-88-7 appears in our catalog under these names: (4-Fluoro-2-methylphenoxy)acetic acid, 95%, 2-(4-Fluoro-2-methylphenoxy)acetic acid, 98%, 4-FLUORO-2-METHYLPHENOXY ACETIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
2-(4-fluoro-2-methylphenoxy)acetic acid (CAS 451-88-7) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenoxy)acetic acid. InChIKey: MJESFQARYVVZSL-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenoxy)acetic acid |
| InChIKey | MJESFQARYVVZSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OCC(=O)O |
Computed by PubChem (NCBI)