cas: 1255945-85-7 — see every product listed under this CAS number, including other names
2-(4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, 97% (CAS 1255945-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F451286-100MG |
| cas | 1255945-85-7 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2575.15 Pln | |
| Fluorochem | 5g | 7604.63 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1838.88 Pln | |
| Ambeed | 5g | 4670.19 Pln | |
| Ambeed | 25g | 12991.69 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 1255945-85-7) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: DYFNQNVMHCQXDI-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | DYFNQNVMHCQXDI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CC(=O)O)F |
Computed by PubChem (NCBI)