cas: 1216563-60-8 — see every product listed under this CAS number, including other names
2-(4-Fluorophenyl)propan-2-amine hydrochloride, 95% (CAS 1216563-60-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A224500-250mg |
| cas | 1216563-60-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 486.64 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1658.81 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-fluorophenyl)propan-2-amine;hydrochloride (CAS 1216563-60-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: 2-(4-fluorophenyl)propan-2-amine;hydrochloride. InChIKey: NCSRKGARCQLHHL-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | 2-(4-fluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | NCSRKGARCQLHHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)