cas: 2467-03-0 — see every product listed under this CAS number, including other names
2-(4-Hydroxybenzyl)phenol, 98% (CAS 2467-03-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A489335-250mg |
| cas | 2467-03-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 493.15 Pln | |
| AmBeed | 5g | 3116.68 Pln | |
| AmBeed | 10g | 5147.80 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(4-hydroxyphenyl)methyl]phenol (CAS 2467-03-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-[(4-hydroxyphenyl)methyl]phenol. InChIKey: LVLNPXCISNPHLE-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-[(4-hydroxyphenyl)methyl]phenol |
| InChIKey | LVLNPXCISNPHLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)