cas: 23353-14-2 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)-4-thiazoleacetic acid, 97%, 97% (CAS 23353-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113MYI-100mg |
| cas | 23353-14-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1509.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (CAS 23353-14-2) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: HWRQFRXTBPYUEK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | HWRQFRXTBPYUEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)