CAS 879636-95-0 appears in our catalog under these names: 2-(3-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(3-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic Acid, 4-Methyl-2-(3-methoxyphenyl)thiazole-5-carboxylic acid, 98%, 98%, 4-Methyl-2-(3-methoxyphenyl)thiazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 500mg, 100mg.
2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 879636-95-0) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WFBWIROXKGGXAW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WFBWIROXKGGXAW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)OC)C(=O)O |
Computed by PubChem (NCBI)