Products 885123-03-5

CAS 885123-03-5 is the registry number for [(2-Formyl-1-methyl-1h-indol-3-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-formyl-1-methylindol-3-yl)sulfanylacetic acid (CAS 885123-03-5) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-(2-formyl-1-methylindol-3-yl)sulfanylacetic acid. InChIKey: ZBXCYUUJNVTEDW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO3S
Molecular weight249.29 g/mol
IUPAC name2-(2-formyl-1-methylindol-3-yl)sulfanylacetic acid
InChIKeyZBXCYUUJNVTEDW-UHFFFAOYSA-N
SMILESCN1C2=CC=CC=C2C(=C1C=O)SCC(=O)O

Computed by PubChem (NCBI)