CAS 23353-14-2 appears in our catalog under these names: 2-(4-Methoxyphenyl)-4-thiazoleacetic acid, 97%, 97%, [2-(4-Methoxyphenyl)-1,3-thiazol-4-yl]acetic acid, 95%, [2-(4-Methoxyphenyl)-1,3-thiazol-4-yl]acetic acid, 97%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (CAS 23353-14-2) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: HWRQFRXTBPYUEK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | HWRQFRXTBPYUEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)