Products 875858-78-9
CAS 875858-78-9 appears in our catalog under these names: 2-[(4-Methylphenoxy)methyl]-1,3-thiazole-4-carboxylic acid, 95%, 2-(4-Methylphenoxymethyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(4-Methylphenoxymethyl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylic acid (CAS 875858-78-9) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: ULXLKNWQMGIDNW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | ULXLKNWQMGIDNW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OCC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)