cas: 3951-10-8 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)acetic anhydride (CAS 3951-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F773589-1G |
| cas | 3951-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 883.04 Pln | |
| Fluorochem | 100g | 2819.86 Pln |
| delivery time | 3-4 weeks |
|---|
[2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate (CAS 3951-10-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: [2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate. InChIKey: KYCAEIXHUXBNTQ-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | [2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate |
| InChIKey | KYCAEIXHUXBNTQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC(=O)OC(=O)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)