cas: 4364-02-7 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)quinoline-4-carboxylic acid, ≥97%, ≥97% (CAS 4364-02-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D94D-50mg |
| cas | 4364-02-7 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 2896.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenyl)quinoline-4-carboxylic acid (CAS 4364-02-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(4-methoxyphenyl)quinoline-4-carboxylic acid. InChIKey: ZCNPYYVKVXSLQF-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | ZCNPYYVKVXSLQF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)