cas: 4364-02-7 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)quinoline-4-carboxylic acid (CAS 4364-02-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014382-1G |
| cas | 4364-02-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 799.74 Pln | |
| Fluorochem | 5g | 3173.90 Pln |
| delivery time | 2-3 weeks |
|---|
2-(4-methoxyphenyl)quinoline-4-carboxylic acid (CAS 4364-02-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(4-methoxyphenyl)quinoline-4-carboxylic acid. InChIKey: ZCNPYYVKVXSLQF-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | ZCNPYYVKVXSLQF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)