CAS 4364-02-7 appears in our catalog under these names: 2-(4-Methoxyphenyl)quinoline-4-carboxylic acid, 97%, 2-(4-Methoxyphenyl)quinoline-4-carboxylic acid, 95%, 2-(4-Methoxyphenyl)quinoline-4-carboxylic acid, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 50mg.
2-(4-methoxyphenyl)quinoline-4-carboxylic acid (CAS 4364-02-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(4-methoxyphenyl)quinoline-4-carboxylic acid. InChIKey: ZCNPYYVKVXSLQF-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | ZCNPYYVKVXSLQF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)