Products 88877-88-7
CAS 88877-88-7 appears in our catalog under these names: 2-[5-(4-Methylphenyl)-1,3-oxazol-2-yl]benzoic acid, 95%, 2-(5-(4-Methylphenyl)-1,3-oxazol-2-yl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoic acid (CAS 88877-88-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoic acid. InChIKey: QHDXXCCWUXBCLN-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoic acid |
| InChIKey | QHDXXCCWUXBCLN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)