CAS 669726-20-9 is the registry number for 2-(4-Hydroxyphenyl)-8-methylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-hydroxyphenyl)-8-methylquinoline-4-carboxylic acid (CAS 669726-20-9) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-8-methylquinoline-4-carboxylic acid. InChIKey: QDIMNIHQSBGSCT-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-8-methylquinoline-4-carboxylic acid |
| InChIKey | QDIMNIHQSBGSCT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)