cas: 65884-40-4 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)thiazolidine-4-carboxylic acid 97% (CAS 65884-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A467703-100mg |
| cas | 65884-40-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1566.31 Pln | |
| Ambeed | 5g | 4558.94 Pln | |
| Ambeed | 10g | 6327.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A467703 |
2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 65884-40-4) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: ZQRSXNJVEHLFCE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | ZQRSXNJVEHLFCE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2NC(CS2)C(=O)O |
Computed by PubChem (NCBI)