cas: 3323-26-0 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)imidazo[1,2-a]pyridine, 98%, 98% (CAS 3323-26-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7H7-100mg |
| cas | 3323-26-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 314.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-nitrophenyl)imidazo[1,2-a]pyridine (CAS 3323-26-0) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-(4-nitrophenyl)imidazo[1,2-a]pyridine. InChIKey: SNBCSKCONKUZBA-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)imidazo[1,2-a]pyridine |
| InChIKey | SNBCSKCONKUZBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)