Products 781674-55-3

CAS 781674-55-3 is the registry number for 2-Phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid (CAS 781674-55-3) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid. InChIKey: LSXBWZKUWXWGNE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9N3O2
Molecular weight239.23 g/mol
IUPAC name2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid
InChIKeyLSXBWZKUWXWGNE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NN3C(=C2C(=O)O)C=CC=N3

Computed by PubChem (NCBI)