CAS 781674-55-3 is the registry number for 2-Phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid (CAS 781674-55-3) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid. InChIKey: LSXBWZKUWXWGNE-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-phenylpyrazolo[1,5-b]pyridazine-3-carboxylic acid |
| InChIKey | LSXBWZKUWXWGNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C(=C2C(=O)O)C=CC=N3 |
Computed by PubChem (NCBI)