Products 1152718-85-8

CAS 1152718-85-8 is the registry number for 2-(1H-Pyrazol-1-yl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-pyrazol-1-ylquinoline-4-carboxylic acid (CAS 1152718-85-8) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-pyrazol-1-ylquinoline-4-carboxylic acid. InChIKey: FKVCCXZRAYMRMV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9N3O2
Molecular weight239.23 g/mol
IUPAC name2-pyrazol-1-ylquinoline-4-carboxylic acid
InChIKeyFKVCCXZRAYMRMV-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC(=N2)N3C=CC=N3)C(=O)O

Computed by PubChem (NCBI)