CAS 1078168-27-0 is the registry number for 1-Phenyl-1h-imidazo[4,5-c]pyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1-phenylimidazo[4,5-c]pyridine-4-carboxylic acid (CAS 1078168-27-0) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 1-phenylimidazo[4,5-c]pyridine-4-carboxylic acid. InChIKey: MIWUWIZZVIPJTR-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 1-phenylimidazo[4,5-c]pyridine-4-carboxylic acid |
| InChIKey | MIWUWIZZVIPJTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2C=CN=C3C(=O)O |
Computed by PubChem (NCBI)