CAS 312496-16-5 appears in our catalog under these names: 2-(Pyridin-3-yl)-1h-benzimidazole-6-carboxylic acid, 95%, 2–Pyridin–3–yl–3H–benzoimidazole–5–carboxylic acid, 2-(3-Pyridyl)benzimidazole-6-carboxylic acid, 97% , 2-(Pyridin-3-yl)-1H-benzo[d]imidazole-6-carboxylic acid 97%, 2-(Pyridin-3-yl)-1h-1,3-benzodiazole-6-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-pyridin-3-yl-3H-benzimidazole-5-carboxylic acid (CAS 312496-16-5) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-pyridin-3-yl-3H-benzimidazole-5-carboxylic acid. InChIKey: DHRPCXYIVJXXJR-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-pyridin-3-yl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | DHRPCXYIVJXXJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=C(N2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)