cas: 22908-28-7 — see every product listed under this CAS number, including other names
2-(5-Chloro-2-nitrophenyl)acetic acid 95% (CAS 22908-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190543-100mg |
| cas | 22908-28-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 659.62 Pln | |
| Ambeed | 250mg | 1037.88 Pln | |
| Ambeed | 1g | 2634.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A190543 |
2-(5-chloro-2-nitrophenyl)acetic acid (CAS 22908-28-7) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(5-chloro-2-nitrophenyl)acetic acid. InChIKey: ISSGDBWGQCOTNA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(5-chloro-2-nitrophenyl)acetic acid |
| InChIKey | ISSGDBWGQCOTNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)