cas: 205692-61-1 — see every product listed under this CAS number, including other names
2-(5-Methoxy-2-nitrophenyl)malonaldehyde hydrate, 97% (CAS 205692-61-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A997431-10g |
| cas | 205692-61-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 3201.31 Pln | |
| AmBeed | 5g | 1847.23 Pln | |
| AmBeed | 25g | 6586.51 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(5-methoxy-2-nitrophenyl)propanedial;hydrate (CAS 205692-61-1) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-(5-methoxy-2-nitrophenyl)propanedial;hydrate. InChIKey: SKQBOFQBGCIELP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-(5-methoxy-2-nitrophenyl)propanedial;hydrate |
| InChIKey | SKQBOFQBGCIELP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])C(C=O)C=O.O |
Computed by PubChem (NCBI)