CAS 148546-84-3 appears in our catalog under these names: Methyl 3,4-dimethoxy-5-nitrobenzoate, 95%, Methyl 3,4-dimethoxy-5-nitrobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 3,4-dimethoxy-5-nitrobenzoate (CAS 148546-84-3) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: methyl 3,4-dimethoxy-5-nitrobenzoate. InChIKey: CRSPPWMPFLPNON-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | methyl 3,4-dimethoxy-5-nitrobenzoate |
| InChIKey | CRSPPWMPFLPNON-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)