CAS 426264-10-0 is the registry number for 2-Methoxyethyl (4-nitrophenyl) carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methoxyethyl (4-nitrophenyl) carbonate (CAS 426264-10-0) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-methoxyethyl (4-nitrophenyl) carbonate. InChIKey: VICULOXVGGBWFP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-methoxyethyl (4-nitrophenyl) carbonate |
| InChIKey | VICULOXVGGBWFP-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)